C24H25ClN2O5S — CID 91186396
ethyl 6-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylpyridine-3-carboxylate (PubChem CID 91186396) has the molecular formula C24H25ClN2O5S and a molecular weight of 488.99 g/mol. Its IUPAC name is ethyl 6-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylpyridine-3-carboxylate.
| Compound Name | ethyl 6-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 91186396 |
| Molecular Formula | C24H25ClN2O5S |
| Molecular Weight | 488.99 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | ethyl 6-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)c2ccc(CCNCC(O)c3cccc(Cl)c3)cc2)nc1 |
| InChI | InChI=1S/C24H25ClN2O5S/c1-2-32-24(29)19-8-11-23(27-15-19)33(30,31)21-9-6-17(7-10-21)12-13-26-16-22(28)18-4-3-5-20(25)14-18/h3-11,14-15,22,26,28H,2,12-13,16H2,1H3 |
| InChIKey | IZQWUGAKLCXXGR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.99 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|