C28H32ClNO6S — CID 90693156
tert-butyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate (PubChem CID 90693156) has the molecular formula C28H32ClNO6S and a molecular weight of 546.09 g/mol. Its IUPAC name is tert-butyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate.
| Compound Name | tert-butyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate |
|---|---|
| PubChem CID | 90693156 |
| Molecular Formula | C28H32ClNO6S |
| Molecular Weight | 546.09 g/mol |
| Exact Mass | 545.16 |
| IUPAC Name | tert-butyl 2-[4-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]phenyl]sulfonylphenoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COc1ccc(S(=O)(=O)c2ccc(CCNCC(O)c3cccc(Cl)c3)cc2)cc1 |
| InChI | InChI=1S/C28H32ClNO6S/c1-28(2,3)36-27(32)19-35-23-9-13-25(14-10-23)37(33,34)24-11-7-20(8-12-24)15-16-30-18-26(31)21-5-4-6-22(29)17-21/h4-14,17,26,30-31H,15-16,18-19H2,1-3H3 |
| InChIKey | RQKVNJBCIDZFOT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.09 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|