C25H28Cl2N2O4 — CID 69055300
2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-N-methylanilino]phenoxy]acetic acid;hydrochloride (PubChem CID 69055300) has the molecular formula C25H28Cl2N2O4 and a molecular weight of 491.42 g/mol. Its IUPAC name is 2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-N-methylanilino]phenoxy]acetic acid;hydrochloride.
| Compound Name | 2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-N-methylanilino]phenoxy]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 69055300 |
| Molecular Formula | C25H28Cl2N2O4 |
| Molecular Weight | 491.42 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | 2-[4-[4-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethyl]-N-methylanilino]phenoxy]acetic acid;hydrochloride |
| SMILES | CN(c1ccc(CCNC[C@@H](O)c2cccc(Cl)c2)cc1)c1ccc(OCC(=O)O)cc1.Cl |
| InChI | InChI=1S/C25H27ClN2O4.ClH/c1-28(22-9-11-23(12-10-22)32-17-25(30)31)21-7-5-18(6-8-21)13-14-27-16-24(29)19-3-2-4-20(26)15-19;/h2-12,15,24,27,29H,13-14,16-17H2,1H3,(H,30,31);1H/t24-;/m1./s1 |
| InChIKey | UGIALUMPFZJXAO-GJFSDDNBSA-N |
| XLogP | 4.86 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.42 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|