C20H22N2O5S — CID 10873862
2-[4-[2-[[2-hydroxy-2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)ethyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 10873862) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is 2-[4-[2-[[2-hydroxy-2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)ethyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[[2-hydroxy-2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)ethyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 10873862 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-[4-[2-[[2-hydroxy-2-(3-methyl-2-oxo-1,3-benzothiazol-6-yl)ethyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | Cn1c(=O)sc2cc(C(O)CNCCc3ccc(OCC(=O)O)cc3)ccc21 |
| InChI | InChI=1S/C20H22N2O5S/c1-22-16-7-4-14(10-18(16)28-20(22)26)17(23)11-21-9-8-13-2-5-15(6-3-13)27-12-19(24)25/h2-7,10,17,21,23H,8-9,11-12H2,1H3,(H,24,25) |
| InChIKey | VGPCIFFLSCJQFJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|