C17H21NO5S — CID 70366796
2-[4-[2-[[(2S)-2-hydroxy-3-thiophen-3-yloxypropyl]amino]ethyl]phenoxy]acetic acid (PubChem CID 70366796) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is 2-[4-[2-[[(2S)-2-hydroxy-3-thiophen-3-yloxypropyl]amino]ethyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[2-[[(2S)-2-hydroxy-3-thiophen-3-yloxypropyl]amino]ethyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 70366796 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 2-[4-[2-[[(2S)-2-hydroxy-3-thiophen-3-yloxypropyl]amino]ethyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(CCNC[C@H](O)COc2ccsc2)cc1 |
| InChI | InChI=1S/C17H21NO5S/c19-14(10-22-16-6-8-24-12-16)9-18-7-5-13-1-3-15(4-2-13)23-11-17(20)21/h1-4,6,8,12,14,18-19H,5,7,9-11H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | DYHMKQRVFSHZAL-AWEZNQCLSA-N |
| XLogP | 1.78 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|