C26H30N2O8S — CID 10230201
2-[4-[4-[2-[[2-[3-(2-aminoethoxy)phenyl]-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyloxyphenoxy]acetic acid (PubChem CID 10230201) has the molecular formula C26H30N2O8S and a molecular weight of 530.60 g/mol. Its IUPAC name is 2-[4-[4-[2-[[2-[3-(2-aminoethoxy)phenyl]-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyloxyphenoxy]acetic acid.
| Compound Name | 2-[4-[4-[2-[[2-[3-(2-aminoethoxy)phenyl]-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyloxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 10230201 |
| Molecular Formula | C26H30N2O8S |
| Molecular Weight | 530.60 g/mol |
| Exact Mass | 530.17 |
| IUPAC Name | 2-[4-[4-[2-[[2-[3-(2-aminoethoxy)phenyl]-2-hydroxyethyl]amino]ethyl]phenyl]sulfonyloxyphenoxy]acetic acid |
| SMILES | NCCOc1cccc(C(O)CNCCc2ccc(S(=O)(=O)Oc3ccc(OCC(=O)O)cc3)cc2)c1 |
| InChI | InChI=1S/C26H30N2O8S/c27-13-15-34-23-3-1-2-20(16-23)25(29)17-28-14-12-19-4-10-24(11-5-19)37(32,33)36-22-8-6-21(7-9-22)35-18-26(30)31/h1-11,16,25,28-29H,12-15,17-18,27H2,(H,30,31) |
| InChIKey | PWTBZOBMTPKETE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 157.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.60 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|