C25H27ClNNaO6S — CID 173221475
sodium;5-[4-[3-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonyl-2-methoxybenzoic acid;hydride (PubChem CID 173221475) has the molecular formula C25H27ClNNaO6S and a molecular weight of 528.00 g/mol. Its IUPAC name is sodium;5-[4-[3-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonyl-2-methoxybenzoic acid;hydride.
| Compound Name | sodium;5-[4-[3-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonyl-2-methoxybenzoic acid;hydride |
|---|---|
| PubChem CID | 173221475 |
| Molecular Formula | C25H27ClNNaO6S |
| Molecular Weight | 528.00 g/mol |
| Exact Mass | 527.11 |
| IUPAC Name | sodium;5-[4-[3-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenyl]sulfonyl-2-methoxybenzoic acid;hydride |
| SMILES | COc1ccc(S(=O)(=O)c2ccc(CCCNC[C@@H](O)c3cccc(Cl)c3)cc2)cc1C(=O)O.[H-].[Na+] |
| InChI | InChI=1S/C25H26ClNO6S.Na.H/c1-33-24-12-11-21(15-22(24)25(29)30)34(31,32)20-9-7-17(8-10-20)4-3-13-27-16-23(28)18-5-2-6-19(26)14-18;;/h2,5-12,14-15,23,27-28H,3-4,13,16H2,1H3,(H,29,30);;/q;+1;-1/t23-;;/m1../s1 |
| InChIKey | ARMACJLDAJARKP-MQWQBNKOSA-N |
| XLogP | 1.25 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.00 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|