C25H28ClNO3S — CID 70500681
1-(3-chlorophenyl)-2-[1-[4-[2-(2-sulfanylphenoxy)ethoxy]phenyl]propan-2-ylamino]ethanol (PubChem CID 70500681) has the molecular formula C25H28ClNO3S and a molecular weight of 458.02 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-2-[1-[4-[2-(2-sulfanylphenoxy)ethoxy]phenyl]propan-2-ylamino]ethanol.
| Compound Name | 1-(3-chlorophenyl)-2-[1-[4-[2-(2-sulfanylphenoxy)ethoxy]phenyl]propan-2-ylamino]ethanol |
|---|---|
| PubChem CID | 70500681 |
| Molecular Formula | C25H28ClNO3S |
| Molecular Weight | 458.02 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 1-(3-chlorophenyl)-2-[1-[4-[2-(2-sulfanylphenoxy)ethoxy]phenyl]propan-2-ylamino]ethanol |
| SMILES | CC(Cc1ccc(OCCOc2ccccc2S)cc1)NCC(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H28ClNO3S/c1-18(27-17-23(28)20-5-4-6-21(26)16-20)15-19-9-11-22(12-10-19)29-13-14-30-24-7-2-3-8-25(24)31/h2-12,16,18,23,27-28,31H,13-15,17H2,1H3 |
| InChIKey | GMWAHJCNRJWKAW-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.02 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|