C18H24ClNNaO5P — CID 173322441
sodium;[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]methylphosphonic acid;hydride (PubChem CID 173322441) has the molecular formula C18H24ClNNaO5P and a molecular weight of 423.81 g/mol. Its IUPAC name is sodium;[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]methylphosphonic acid;hydride.
| Compound Name | sodium;[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]methylphosphonic acid;hydride |
|---|---|
| PubChem CID | 173322441 |
| Molecular Formula | C18H24ClNNaO5P |
| Molecular Weight | 423.81 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | sodium;[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]phenoxy]methylphosphonic acid;hydride |
| SMILES | CC(Cc1ccc(OCP(=O)(O)O)cc1)NCC(O)c1cccc(Cl)c1.[H-].[Na+] |
| InChI | InChI=1S/C18H23ClNO5P.Na.H/c1-13(20-11-18(21)15-3-2-4-16(19)10-15)9-14-5-7-17(8-6-14)25-12-26(22,23)24;;/h2-8,10,13,18,20-21H,9,11-12H2,1H3,(H2,22,23,24);;/q;+1;-1 |
| InChIKey | CTEUGBBBRYFYHT-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.81 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|