C29H31ClN2O7S — CID 67650193
dimethyl 1-(benzenesulfonyl)-5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate (PubChem CID 67650193) has the molecular formula C29H31ClN2O7S and a molecular weight of 587.09 g/mol. Its IUPAC name is dimethyl 1-(benzenesulfonyl)-5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate.
| Compound Name | dimethyl 1-(benzenesulfonyl)-5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 67650193 |
| Molecular Formula | C29H31ClN2O7S |
| Molecular Weight | 587.09 g/mol |
| Exact Mass | 586.15 |
| IUPAC Name | dimethyl 1-(benzenesulfonyl)-5-[(2R)-2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(C[C@@H](C)NCC(O)c3cccc(Cl)c3)ccc2N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H31ClN2O7S/c1-19(31-18-26(33)21-8-7-9-23(30)16-21)14-20-12-13-25-22(15-20)17-29(27(34)38-2,28(35)39-3)32(25)40(36,37)24-10-5-4-6-11-24/h4-13,15-16,19,26,31,33H,14,17-18H2,1-3H3/t19-,26?/m1/s1 |
| InChIKey | CVLJIBXSMOBYEA-ICCFGIFFSA-N |
| XLogP | 3.43 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.09 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|