C25H29ClN2O6 — CID 67650217
dimethyl 1-acetyl-5-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate (PubChem CID 67650217) has the molecular formula C25H29ClN2O6 and a molecular weight of 488.97 g/mol. Its IUPAC name is dimethyl 1-acetyl-5-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate.
| Compound Name | dimethyl 1-acetyl-5-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 67650217 |
| Molecular Formula | C25H29ClN2O6 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | dimethyl 1-acetyl-5-[2-[[(2S)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-3H-indole-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)Cc2cc(CC(C)NC[C@@H](O)c3cccc(Cl)c3)ccc2N1C(C)=O |
| InChI | InChI=1S/C25H29ClN2O6/c1-15(27-14-22(30)18-6-5-7-20(26)12-18)10-17-8-9-21-19(11-17)13-25(23(31)33-3,24(32)34-4)28(21)16(2)29/h5-9,11-12,15,22,27,30H,10,13-14H2,1-4H3/t15?,22-/m1/s1 |
| InChIKey | OYGHAHVSOSFAMM-ZZAPORBBSA-N |
| XLogP | 2.59 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|