C28H37ClN2O6 — CID 67587984
5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(dibutylcarbamoyl)-1,3-benzodioxole-2-carboxylic acid (PubChem CID 67587984) has the molecular formula C28H37ClN2O6 and a molecular weight of 533.07 g/mol. Its IUPAC name is 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(dibutylcarbamoyl)-1,3-benzodioxole-2-carboxylic acid.
| Compound Name | 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(dibutylcarbamoyl)-1,3-benzodioxole-2-carboxylic acid |
|---|---|
| PubChem CID | 67587984 |
| Molecular Formula | C28H37ClN2O6 |
| Molecular Weight | 533.07 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 5-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-2-(dibutylcarbamoyl)-1,3-benzodioxole-2-carboxylic acid |
| SMILES | CCCCN(CCCC)C(=O)C1(C(=O)O)Oc2ccc(CC(C)NCC(O)c3cccc(Cl)c3)cc2O1 |
| InChI | InChI=1S/C28H37ClN2O6/c1-4-6-13-31(14-7-5-2)26(33)28(27(34)35)36-24-12-11-20(16-25(24)37-28)15-19(3)30-18-23(32)21-9-8-10-22(29)17-21/h8-12,16-17,19,23,30,32H,4-7,13-15,18H2,1-3H3,(H,34,35) |
| InChIKey | KHOCFUJMTVASCC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.07 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|