C12H9BrNa2O6 — CID 139706167
disodium;5-[(2R)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 139706167) has the molecular formula C12H9BrNa2O6 and a molecular weight of 375.08 g/mol. Its IUPAC name is disodium;5-[(2R)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | disodium;5-[(2R)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 139706167 |
| Molecular Formula | C12H9BrNa2O6 |
| Molecular Weight | 375.08 g/mol |
| Exact Mass | 373.94 |
| IUPAC Name | disodium;5-[(2R)-2-bromopropyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | C[C@@H](Br)Cc1ccc2c(c1)OC(C(=O)[O-])(C(=O)[O-])O2.[Na+].[Na+] |
| InChI | InChI=1S/C12H11BrO6.2Na/c1-6(13)4-7-2-3-8-9(5-7)19-12(18-8,10(14)15)11(16)17;;/h2-3,5-6H,4H2,1H3,(H,14,15)(H,16,17);;/q;2*+1/p-2/t6-;;/m1../s1 |
| InChIKey | MIGVJDATGOUPOY-QYCVXMPOSA-L |
| XLogP | -7.01 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.08 |
| LogP ≤ 5 | -7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|