C36H37NO10 — CID 57283561
bis(4-methoxyphenyl) 5-[2-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate (PubChem CID 57283561) has the molecular formula C36H37NO10 and a molecular weight of 643.69 g/mol. Its IUPAC name is bis(4-methoxyphenyl) 5-[2-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate.
| Compound Name | bis(4-methoxyphenyl) 5-[2-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
|---|---|
| PubChem CID | 57283561 |
| Molecular Formula | C36H37NO10 |
| Molecular Weight | 643.69 g/mol |
| Exact Mass | 643.24 |
| IUPAC Name | bis(4-methoxyphenyl) 5-[2-[[2-hydroxy-3-(4-methylphenoxy)propyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate |
| SMILES | COc1ccc(OC(=O)C2(C(=O)Oc3ccc(OC)cc3)Oc3ccc(CC(C)NCC(O)COc4ccc(C)cc4)cc3O2)cc1 |
| InChI | InChI=1S/C36H37NO10/c1-23-5-8-29(9-6-23)43-22-26(38)21-37-24(2)19-25-7-18-32-33(20-25)47-36(46-32,34(39)44-30-14-10-27(41-3)11-15-30)35(40)45-31-16-12-28(42-4)13-17-31/h5-18,20,24,26,37-38H,19,21-22H2,1-4H3 |
| InChIKey | IXWIHXUKUSHACB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.69 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|