C18H26O5 — CID 167976497
ethyl 4-[(4-ethoxyphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylate (PubChem CID 167976497) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is ethyl 4-[(4-ethoxyphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(4-ethoxyphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 167976497 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | ethyl 4-[(4-ethoxyphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(COc2ccc(OCC)cc2)CC1 |
| InChI | InChI=1S/C18H26O5/c1-3-21-15-5-7-16(8-6-15)23-13-18(20)11-9-14(10-12-18)17(19)22-4-2/h5-8,14,20H,3-4,9-13H2,1-2H3 |
| InChIKey | ARKIJIIJRPMOTK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |