C15H18O5 — CID 106497494
4-[(4-formylphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylic acid (PubChem CID 106497494) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 4-[(4-formylphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-formylphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 106497494 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4-[(4-formylphenoxy)methyl]-4-hydroxycyclohexane-1-carboxylic acid |
| SMILES | O=Cc1ccc(OCC2(O)CCC(C(=O)O)CC2)cc1 |
| InChI | InChI=1S/C15H18O5/c16-9-11-1-3-13(4-2-11)20-10-15(19)7-5-12(6-8-15)14(17)18/h1-4,9,12,19H,5-8,10H2,(H,17,18) |
| InChIKey | XQPXDMNBPROYKL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|