C15H27NO3 — CID 106498940
ethyl 4-[(cyclopentylamino)methyl]-4-hydroxycyclohexane-1-carboxylate (PubChem CID 106498940) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is ethyl 4-[(cyclopentylamino)methyl]-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(cyclopentylamino)methyl]-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106498940 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethyl 4-[(cyclopentylamino)methyl]-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CNC2CCCC2)CC1 |
| InChI | InChI=1S/C15H27NO3/c1-2-19-14(17)12-7-9-15(18,10-8-12)11-16-13-5-3-4-6-13/h12-13,16,18H,2-11H2,1H3 |
| InChIKey | QLALUXVIYVUXQI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |