C16H31NO4 — CID 106499888
ethyl 4-[[(2-ethoxy-2-methylpropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate (PubChem CID 106499888) has the molecular formula C16H31NO4 and a molecular weight of 301.43 g/mol. Its IUPAC name is ethyl 4-[[(2-ethoxy-2-methylpropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[(2-ethoxy-2-methylpropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106499888 |
| Molecular Formula | C16H31NO4 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | ethyl 4-[[(2-ethoxy-2-methylpropyl)amino]methyl]-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CNCC(C)(C)OCC)CC1 |
| InChI | InChI=1S/C16H31NO4/c1-5-20-14(18)13-7-9-16(19,10-8-13)12-17-11-15(3,4)21-6-2/h13,17,19H,5-12H2,1-4H3 |
| InChIKey | JXJZAKZBNGKQTF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |