C16H30O5 — CID 106497816
ethyl 4-hydroxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]cyclohexane-1-carboxylate (PubChem CID 106497816) has the molecular formula C16H30O5 and a molecular weight of 302.41 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106497816 |
| Molecular Formula | C16H30O5 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | ethyl 4-hydroxy-4-[2-[(2-methylpropan-2-yl)oxy]ethoxymethyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(COCCOC(C)(C)C)CC1 |
| InChI | InChI=1S/C16H30O5/c1-5-20-14(17)13-6-8-16(18,9-7-13)12-19-10-11-21-15(2,3)4/h13,18H,5-12H2,1-4H3 |
| InChIKey | ABDLFURCLHOERE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|