C13H24O3S — CID 106498025
ethyl 4-hydroxy-4-(propylsulfanylmethyl)cyclohexane-1-carboxylate (PubChem CID 106498025) has the molecular formula C13H24O3S and a molecular weight of 260.40 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-(propylsulfanylmethyl)cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-(propylsulfanylmethyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106498025 |
| Molecular Formula | C13H24O3S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | ethyl 4-hydroxy-4-(propylsulfanylmethyl)cyclohexane-1-carboxylate |
| SMILES | CCCSCC1(O)CCC(C(=O)OCC)CC1 |
| InChI | InChI=1S/C13H24O3S/c1-3-9-17-10-13(15)7-5-11(6-8-13)12(14)16-4-2/h11,15H,3-10H2,1-2H3 |
| InChIKey | XOKRATCJWUPJNU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|