C14H27NO3S — CID 106498184
ethyl 4-(4-aminobutan-2-ylsulfanylmethyl)-4-hydroxycyclohexane-1-carboxylate (PubChem CID 106498184) has the molecular formula C14H27NO3S and a molecular weight of 289.44 g/mol. Its IUPAC name is ethyl 4-(4-aminobutan-2-ylsulfanylmethyl)-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-(4-aminobutan-2-ylsulfanylmethyl)-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106498184 |
| Molecular Formula | C14H27NO3S |
| Molecular Weight | 289.44 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | ethyl 4-(4-aminobutan-2-ylsulfanylmethyl)-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CSC(C)CCN)CC1 |
| InChI | InChI=1S/C14H27NO3S/c1-3-18-13(16)12-4-7-14(17,8-5-12)10-19-11(2)6-9-15/h11-12,17H,3-10,15H2,1-2H3 |
| InChIKey | WXDDTACIBNROBY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.44 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |