C15H22N2O3S — CID 106498100
ethyl 4-[(3-amino-4-pyridinyl)sulfanylmethyl]-4-hydroxycyclohexane-1-carboxylate (PubChem CID 106498100) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is ethyl 4-[(3-amino-4-pyridinyl)sulfanylmethyl]-4-hydroxycyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[(3-amino-4-pyridinyl)sulfanylmethyl]-4-hydroxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106498100 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | ethyl 4-[(3-amino-4-pyridinyl)sulfanylmethyl]-4-hydroxycyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CSc2ccncc2N)CC1 |
| InChI | InChI=1S/C15H22N2O3S/c1-2-20-14(18)11-3-6-15(19,7-4-11)10-21-13-5-8-17-9-12(13)16/h5,8-9,11,19H,2-4,6-7,10,16H2,1H3 |
| InChIKey | QOBYJPKCLKVJRO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |