C17H24O3S — CID 106498084
ethyl 4-hydroxy-4-[(3-methylphenyl)sulfanylmethyl]cyclohexane-1-carboxylate (PubChem CID 106498084) has the molecular formula C17H24O3S and a molecular weight of 308.44 g/mol. Its IUPAC name is ethyl 4-hydroxy-4-[(3-methylphenyl)sulfanylmethyl]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-hydroxy-4-[(3-methylphenyl)sulfanylmethyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 106498084 |
| Molecular Formula | C17H24O3S |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | ethyl 4-hydroxy-4-[(3-methylphenyl)sulfanylmethyl]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(O)(CSc2cccc(C)c2)CC1 |
| InChI | InChI=1S/C17H24O3S/c1-3-20-16(18)14-7-9-17(19,10-8-14)12-21-15-6-4-5-13(2)11-15/h4-6,11,14,19H,3,7-10,12H2,1-2H3 |
| InChIKey | GLNVGQXADXTWMC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |