C11H15F2N3 — CID 62616143
2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine (PubChem CID 62616143) has the molecular formula C11H15F2N3 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine.
| Compound Name | 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 62616143 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2N3/c1-2-15-11(14)16-4-3-8-5-9(12)7-10(13)6-8/h5-7H,2-4H2,1H3,(H3,14,15,16) |
| InChIKey | NMNQTNVSJALNMK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|