About 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine
2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine (PubChem CID 62616143) has the molecular formula C11H15F2N3
and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine.
Molecular Properties
| Compound Name | 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine |
| PubChem CID | 62616143 |
| Molecular Formula | C11H15F2N3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H15F2N3/c1-2-15-11(14)16-4-3-8-5-9(12)7-10(13)6-8/h5-7H,2-4H2,1H3,(H3,14,15,16) |
| InChIKey | NMNQTNVSJALNMK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine?
The IUPAC name of 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine (CID 62616143) is 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine.
What is the SMILES notation for 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine?
The canonical SMILES for 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine is CCN/C(N)=N/CCc1cc(F)cc(F)c1.
What is the InChIKey of 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine?
The InChIKey is NMNQTNVSJALNMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3/c1-2-15-11(14)16-4-3-8-5-9(12)7-10(13)6-8/h5-7H,2-4H2,1H3,(H3,14,15,16).
What are the key properties of 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine?
2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine has a molecular weight of 227.26 g/mol, XLogP of 1.43, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-difluorophenyl)ethyl]-1-ethylguanidine is sourced from PubChem (CID 62616143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).