C12H16F2N2 — CID 63172943
N'-[2-(3,5-difluorophenyl)ethyl]butanimidamide (PubChem CID 63172943) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is N'-[2-(3,5-difluorophenyl)ethyl]butanimidamide.
| Compound Name | N'-[2-(3,5-difluorophenyl)ethyl]butanimidamide |
|---|---|
| PubChem CID | 63172943 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | N'-[2-(3,5-difluorophenyl)ethyl]butanimidamide |
| SMILES | CCC/C(N)=N\CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H16F2N2/c1-2-3-12(15)16-5-4-9-6-10(13)8-11(14)7-9/h6-8H,2-5H2,1H3,(H2,15,16) |
| InChIKey | DANYEBNBQRBBED-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|