C12H16N2 — CID 10656792
2-benzyl-2,3,4,5-tetrahydropyridin-6-amine (PubChem CID 10656792) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-benzyl-2,3,4,5-tetrahydropyridin-6-amine.
| Compound Name | 2-benzyl-2,3,4,5-tetrahydropyridin-6-amine |
|---|---|
| PubChem CID | 10656792 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-benzyl-2,3,4,5-tetrahydropyridin-6-amine |
| SMILES | NC1=NC(Cc2ccccc2)CCC1 |
| InChI | InChI=1S/C12H16N2/c13-12-8-4-7-11(14-12)9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,13,14) |
| InChIKey | SGCVJGBIFFHASJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |