C11H17N5 — CID 137125536
2-[2-(5-methylpyrimidin-2-yl)ethyl]-1-prop-2-enylguanidine (PubChem CID 137125536) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is 2-[2-(5-methylpyrimidin-2-yl)ethyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[2-(5-methylpyrimidin-2-yl)ethyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 137125536 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 2-[2-(5-methylpyrimidin-2-yl)ethyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CCc1ncc(C)cn1 |
| InChI | InChI=1S/C11H17N5/c1-3-5-13-11(12)14-6-4-10-15-7-9(2)8-16-10/h3,7-8H,1,4-6H2,2H3,(H3,12,13,14) |
| InChIKey | LTSYUGBMBMMKHG-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|