C9H13N7 — CID 137158978
2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-prop-2-enylguanidine (PubChem CID 137158978) has the molecular formula C9H13N7 and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 137158978 |
| Molecular Formula | C9H13N7 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CCn1cnc(C#N)n1 |
| InChI | InChI=1S/C9H13N7/c1-2-3-12-9(11)13-4-5-16-7-14-8(6-10)15-16/h2,7H,1,3-5H2,(H3,11,12,13) |
| InChIKey | CPSJRGXQOFMUKQ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|