C14H17N7 — CID 120973355
2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 120973355) has the molecular formula C14H17N7 and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 120973355 |
| Molecular Formula | C14H17N7 |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/CCn2cnc(C#N)n2)cc1C |
| InChI | InChI=1S/C14H17N7/c1-10-3-4-12(7-11(10)2)19-14(16)17-5-6-21-9-18-13(8-15)20-21/h3-4,7,9H,5-6H2,1-2H3,(H3,16,17,19) |
| InChIKey | PFCJJWWSSSBONC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|