C10H18IN7 — CID 120973356
2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine;hydroiodide (PubChem CID 120973356) has the molecular formula C10H18IN7 and a molecular weight of 363.21 g/mol. Its IUPAC name is 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine;hydroiodide.
| Compound Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120973356 |
| Molecular Formula | C10H18IN7 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 363.07 |
| IUPAC Name | 2-[2-(3-cyano-1,2,4-triazol-1-yl)ethyl]-1,1-diethylguanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CCn1cnc(C#N)n1.I |
| InChI | InChI=1S/C10H17N7.HI/c1-3-16(4-2)10(12)13-5-6-17-8-14-9(7-11)15-17;/h8H,3-6H2,1-2H3,(H2,12,13);1H |
| InChIKey | FDEAORLZZAXVBH-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 96.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|