C9H18N6 — CID 119118239
1,1-diethyl-2-[2-(1,2,4-triazol-1-yl)ethyl]guanidine (PubChem CID 119118239) has the molecular formula C9H18N6 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,1-diethyl-2-[2-(1,2,4-triazol-1-yl)ethyl]guanidine.
| Compound Name | 1,1-diethyl-2-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 119118239 |
| Molecular Formula | C9H18N6 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | 1,1-diethyl-2-[2-(1,2,4-triazol-1-yl)ethyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/CCn1cncn1 |
| InChI | InChI=1S/C9H18N6/c1-3-14(4-2)9(10)12-5-6-15-8-11-7-13-15/h7-8H,3-6H2,1-2H3,(H2,10,12) |
| InChIKey | CXIGZQZCTLHKAR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|