C10H18IN5 — CID 122097870
1,1-diethyl-2-[(4-iodo-1-methylpyrazol-3-yl)methyl]guanidine (PubChem CID 122097870) has the molecular formula C10H18IN5 and a molecular weight of 335.19 g/mol. Its IUPAC name is 1,1-diethyl-2-[(4-iodo-1-methylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1,1-diethyl-2-[(4-iodo-1-methylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 122097870 |
| Molecular Formula | C10H18IN5 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 1,1-diethyl-2-[(4-iodo-1-methylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN(CC)/C(N)=N/Cc1nn(C)cc1I |
| InChI | InChI=1S/C10H18IN5/c1-4-16(5-2)10(12)13-6-9-8(11)7-15(3)14-9/h7H,4-6H2,1-3H3,(H2,12,13) |
| InChIKey | WOKAPLHSWNJIPO-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|