C13H22IN3S — CID 111079356
1,1-diethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111079356) has the molecular formula C13H22IN3S and a molecular weight of 379.31 g/mol. Its IUPAC name is 1,1-diethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111079356 |
| Molecular Formula | C13H22IN3S |
| Molecular Weight | 379.31 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 1,1-diethyl-2-[(4-methylsulfanylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/Cc1ccc(SC)cc1.I |
| InChI | InChI=1S/C13H21N3S.HI/c1-4-16(5-2)13(14)15-10-11-6-8-12(17-3)9-7-11;/h6-9H,4-5,10H2,1-3H3,(H2,14,15);1H |
| InChIKey | CXWIUJBZALFVJD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|