C11H20N4 — CID 112672029
N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-methylpropanimidamide (PubChem CID 112672029) has the molecular formula C11H20N4 and a molecular weight of 208.31 g/mol. Its IUPAC name is N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-methylpropanimidamide.
| Compound Name | N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-methylpropanimidamide |
|---|---|
| PubChem CID | 112672029 |
| Molecular Formula | C11H20N4 |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.17 |
| IUPAC Name | N'-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-2-methylpropanimidamide |
| SMILES | CCc1nn(C)cc1C/N=C(/N)C(C)C |
| InChI | InChI=1S/C11H20N4/c1-5-10-9(7-15(4)14-10)6-13-11(12)8(2)3/h7-8H,5-6H2,1-4H3,(H2,12,13) |
| InChIKey | YLJPDBFDMINYJV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 56.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|