C10H19N3 — CID 112669719
1-(3-ethyl-1-methylpyrazol-4-yl)butan-2-amine (PubChem CID 112669719) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylpyrazol-4-yl)butan-2-amine.
| Compound Name | 1-(3-ethyl-1-methylpyrazol-4-yl)butan-2-amine |
|---|---|
| PubChem CID | 112669719 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 1-(3-ethyl-1-methylpyrazol-4-yl)butan-2-amine |
| SMILES | CCc1nn(C)cc1CC(N)CC |
| InChI | InChI=1S/C10H19N3/c1-4-9(11)6-8-7-13(3)12-10(8)5-2/h7,9H,4-6,11H2,1-3H3 |
| InChIKey | WSRJYCQRYCQWSE-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |