C13H22N4S — CID 136949279
(4S)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 136949279) has the molecular formula C13H22N4S and a molecular weight of 266.41 g/mol. Its IUPAC name is (4S)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine.
| Compound Name | (4S)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136949279 |
| Molecular Formula | C13H22N4S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | (4S)-N-[(3-ethyl-1-methylpyrazol-4-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | CCc1nn(C)cc1C/N=C1/N[C@@H](C(C)C)CS1 |
| InChI | InChI=1S/C13H22N4S/c1-5-11-10(7-17(4)16-11)6-14-13-15-12(8-18-13)9(2)3/h7,9,12H,5-6,8H2,1-4H3,(H,14,15)/t12-/m1/s1 |
| InChIKey | VUWVUBCITRIDML-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|