C12H22N2S2 — CID 136762665
N-[(1-methylsulfanylcyclobutyl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 136762665) has the molecular formula C12H22N2S2 and a molecular weight of 258.46 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclobutyl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine.
| Compound Name | N-[(1-methylsulfanylcyclobutyl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136762665 |
| Molecular Formula | C12H22N2S2 |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[(1-methylsulfanylcyclobutyl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | CSC1(C/N=C2/NC(C(C)C)CS2)CCC1 |
| InChI | InChI=1S/C12H22N2S2/c1-9(2)10-7-16-11(14-10)13-8-12(15-3)5-4-6-12/h9-10H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | HIZANRSVWLOZGS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|