C8H15N3OS — CID 136871645
2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide (PubChem CID 136871645) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is 2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide.
| Compound Name | 2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide |
|---|---|
| PubChem CID | 136871645 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]acetamide |
| SMILES | CC(C)C1CS/C(=N\CC(N)=O)N1 |
| InChI | InChI=1S/C8H15N3OS/c1-5(2)6-4-13-8(11-6)10-3-7(9)12/h5-6H,3-4H2,1-2H3,(H2,9,12)(H,10,11) |
| InChIKey | ZYVBNLOITFJMOF-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|