C11H15ClN2S2 — CID 136871812
N-[(5-chlorothiophen-2-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 136871812) has the molecular formula C11H15ClN2S2 and a molecular weight of 274.84 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136871812 |
| Molecular Formula | C11H15ClN2S2 |
| Molecular Weight | 274.84 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-4-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | CC(C)C1CS/C(=N\Cc2ccc(Cl)s2)N1 |
| InChI | InChI=1S/C11H15ClN2S2/c1-7(2)9-6-15-11(14-9)13-5-8-3-4-10(12)16-8/h3-4,7,9H,5-6H2,1-2H3,(H,13,14) |
| InChIKey | GTLALIFSQXMUFK-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|