C15H25ClN2S — CID 64838257
1-[(5-chlorothiophen-2-yl)methyl]-2,5-di(propan-2-yl)piperazine (PubChem CID 64838257) has the molecular formula C15H25ClN2S and a molecular weight of 300.90 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2,5-di(propan-2-yl)piperazine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2,5-di(propan-2-yl)piperazine |
|---|---|
| PubChem CID | 64838257 |
| Molecular Formula | C15H25ClN2S |
| Molecular Weight | 300.90 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2,5-di(propan-2-yl)piperazine |
| SMILES | CC(C)C1CN(Cc2ccc(Cl)s2)C(C(C)C)CN1 |
| InChI | InChI=1S/C15H25ClN2S/c1-10(2)13-9-18(14(7-17-13)11(3)4)8-12-5-6-15(16)19-12/h5-6,10-11,13-14,17H,7-9H2,1-4H3 |
| InChIKey | UBJDFQAVTUXRHV-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.90 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |