C16H27ClN2S — CID 64838073
1-[(5-chlorothiophen-2-yl)methyl]-2-(2-methylpropyl)-5-propan-2-ylpiperazine (PubChem CID 64838073) has the molecular formula C16H27ClN2S and a molecular weight of 314.93 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2-(2-methylpropyl)-5-propan-2-ylpiperazine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-(2-methylpropyl)-5-propan-2-ylpiperazine |
|---|---|
| PubChem CID | 64838073 |
| Molecular Formula | C16H27ClN2S |
| Molecular Weight | 314.93 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-(2-methylpropyl)-5-propan-2-ylpiperazine |
| SMILES | CC(C)CC1CNC(C(C)C)CN1Cc1ccc(Cl)s1 |
| InChI | InChI=1S/C16H27ClN2S/c1-11(2)7-13-8-18-15(12(3)4)10-19(13)9-14-5-6-16(17)20-14/h5-6,11-13,15,18H,7-10H2,1-4H3 |
| InChIKey | PAVWDPSWDKCKEL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.93 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |