C17H27ClN2S — CID 64847233
1-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-2-methyl-5-(2-methylpropyl)piperazine (PubChem CID 64847233) has the molecular formula C17H27ClN2S and a molecular weight of 326.94 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-2-methyl-5-(2-methylpropyl)piperazine.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-2-methyl-5-(2-methylpropyl)piperazine |
|---|---|
| PubChem CID | 64847233 |
| Molecular Formula | C17H27ClN2S |
| Molecular Weight | 326.94 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-cyclopropyl-2-methyl-5-(2-methylpropyl)piperazine |
| SMILES | CC(C)CC1CN(Cc2ccc(Cl)s2)C(C)(C2CC2)CN1 |
| InChI | InChI=1S/C17H27ClN2S/c1-12(2)8-14-9-20(10-15-6-7-16(18)21-15)17(3,11-19-14)13-4-5-13/h6-7,12-14,19H,4-5,8-11H2,1-3H3 |
| InChIKey | GNELMFQKUSTRIW-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.94 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |