C17H21N3S — CID 136871850
4-propan-2-yl-N-(2-quinolin-8-ylethyl)-1,3-thiazolidin-2-imine (PubChem CID 136871850) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-propan-2-yl-N-(2-quinolin-8-ylethyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-propan-2-yl-N-(2-quinolin-8-ylethyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136871850 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-propan-2-yl-N-(2-quinolin-8-ylethyl)-1,3-thiazolidin-2-imine |
| SMILES | CC(C)C1CS/C(=N/CCc2cccc3cccnc23)N1 |
| InChI | InChI=1S/C17H21N3S/c1-12(2)15-11-21-17(20-15)19-10-8-14-6-3-5-13-7-4-9-18-16(13)14/h3-7,9,12,15H,8,10-11H2,1-2H3,(H,19,20) |
| InChIKey | CTKSEUOXZBLKGM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|