C12H25N3OS — CID 136896920
N,N-dimethyl-2-[2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]ethoxy]ethanamine (PubChem CID 136896920) has the molecular formula C12H25N3OS and a molecular weight of 259.42 g/mol. Its IUPAC name is N,N-dimethyl-2-[2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]ethoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]ethoxy]ethanamine |
|---|---|
| PubChem CID | 136896920 |
| Molecular Formula | C12H25N3OS |
| Molecular Weight | 259.42 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N,N-dimethyl-2-[2-[(4-propan-2-yl-1,3-thiazolidin-2-ylidene)amino]ethoxy]ethanamine |
| SMILES | CC(C)C1CS/C(=N\CCOCCN(C)C)N1 |
| InChI | InChI=1S/C12H25N3OS/c1-10(2)11-9-17-12(14-11)13-5-7-16-8-6-15(3)4/h10-11H,5-9H2,1-4H3,(H,13,14) |
| InChIKey | KYODKRMZSRUSPF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.42 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|