C14H20N2OS — CID 136871727
N-(2-phenoxyethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine (PubChem CID 136871727) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine.
| Compound Name | N-(2-phenoxyethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136871727 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(2-phenoxyethyl)-4-propan-2-yl-1,3-thiazolidin-2-imine |
| SMILES | CC(C)C1CS/C(=N\CCOc2ccccc2)N1 |
| InChI | InChI=1S/C14H20N2OS/c1-11(2)13-10-18-14(16-13)15-8-9-17-12-6-4-3-5-7-12/h3-7,11,13H,8-10H2,1-2H3,(H,15,16) |
| InChIKey | CVSFDJKNJAKOJX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|