About N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine
N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine (PubChem CID 135965221) has the molecular formula C14H20N2OS
and a molecular weight of 264.39 g/mol. Its IUPAC name is N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine.
Molecular Properties
| Compound Name | N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine |
| PubChem CID | 135965221 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine |
| SMILES | COCCCC/N=C1/NC(c2ccccc2)CS1 |
| InChI | InChI=1S/C14H20N2OS/c1-17-10-6-5-9-15-14-16-13(11-18-14)12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11H2,1H3,(H,15,16) |
| InChIKey | RAPWNLYOWOOVRK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine?
The IUPAC name of N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine (CID 135965221) is N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine.
What is the SMILES notation for N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine?
The canonical SMILES for N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine is COCCCC/N=C1/NC(c2ccccc2)CS1.
What is the InChIKey of N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine?
The InChIKey is RAPWNLYOWOOVRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2OS/c1-17-10-6-5-9-15-14-16-13(11-18-14)12-7-3-2-4-8-12/h2-4,7-8,13H,5-6,9-11H2,1H3,(H,15,16).
What are the key properties of N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine?
N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine has a molecular weight of 264.39 g/mol, XLogP of 2.85, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methoxybutyl)-4-phenyl-1,3-thiazolidin-2-imine is sourced from PubChem (CID 135965221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).