C17H25N3S — CID 135965275
4-phenyl-N-(2-piperidin-1-ylpropyl)-1,3-thiazolidin-2-imine (PubChem CID 135965275) has the molecular formula C17H25N3S and a molecular weight of 303.47 g/mol. Its IUPAC name is 4-phenyl-N-(2-piperidin-1-ylpropyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-phenyl-N-(2-piperidin-1-ylpropyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 135965275 |
| Molecular Formula | C17H25N3S |
| Molecular Weight | 303.47 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 4-phenyl-N-(2-piperidin-1-ylpropyl)-1,3-thiazolidin-2-imine |
| SMILES | CC(C/N=C1/NC(c2ccccc2)CS1)N1CCCCC1 |
| InChI | InChI=1S/C17H25N3S/c1-14(20-10-6-3-7-11-20)12-18-17-19-16(13-21-17)15-8-4-2-5-9-15/h2,4-5,8-9,14,16H,3,6-7,10-13H2,1H3,(H,18,19) |
| InChIKey | KHBJXQZPMMIYDO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|