C17H24N2S — CID 136883428
N-(3-cyclopentylpropyl)-4-phenyl-1,3-thiazolidin-2-imine (PubChem CID 136883428) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N-(3-cyclopentylpropyl)-4-phenyl-1,3-thiazolidin-2-imine.
| Compound Name | N-(3-cyclopentylpropyl)-4-phenyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136883428 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-(3-cyclopentylpropyl)-4-phenyl-1,3-thiazolidin-2-imine |
| SMILES | c1ccc(C2CS/C(=N\CCCC3CCCC3)N2)cc1 |
| InChI | InChI=1S/C17H24N2S/c1-2-10-15(11-3-1)16-13-20-17(19-16)18-12-6-9-14-7-4-5-8-14/h1-3,10-11,14,16H,4-9,12-13H2,(H,18,19) |
| InChIKey | DKXLWNDNQGTSSO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|