C18H28N2S — CID 136701825
N-(7-methyloctyl)-4-phenyl-1,3-thiazolidin-2-imine (PubChem CID 136701825) has the molecular formula C18H28N2S and a molecular weight of 304.50 g/mol. Its IUPAC name is N-(7-methyloctyl)-4-phenyl-1,3-thiazolidin-2-imine.
| Compound Name | N-(7-methyloctyl)-4-phenyl-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136701825 |
| Molecular Formula | C18H28N2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | N-(7-methyloctyl)-4-phenyl-1,3-thiazolidin-2-imine |
| SMILES | CC(C)CCCCCC/N=C1/NC(c2ccccc2)CS1 |
| InChI | InChI=1S/C18H28N2S/c1-15(2)10-6-3-4-9-13-19-18-20-17(14-21-18)16-11-7-5-8-12-16/h5,7-8,11-12,15,17H,3-4,6,9-10,13-14H2,1-2H3,(H,19,20) |
| InChIKey | FNGFKXJDOCLOSG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|