C14H28N2S — CID 136701829
4-ethyl-N-(7-methyloctyl)-1,3-thiazolidin-2-imine (PubChem CID 136701829) has the molecular formula C14H28N2S and a molecular weight of 256.46 g/mol. Its IUPAC name is 4-ethyl-N-(7-methyloctyl)-1,3-thiazolidin-2-imine.
| Compound Name | 4-ethyl-N-(7-methyloctyl)-1,3-thiazolidin-2-imine |
|---|---|
| PubChem CID | 136701829 |
| Molecular Formula | C14H28N2S |
| Molecular Weight | 256.46 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 4-ethyl-N-(7-methyloctyl)-1,3-thiazolidin-2-imine |
| SMILES | CCC1CS/C(=N\CCCCCCC(C)C)N1 |
| InChI | InChI=1S/C14H28N2S/c1-4-13-11-17-14(16-13)15-10-8-6-5-7-9-12(2)3/h12-13H,4-11H2,1-3H3,(H,15,16) |
| InChIKey | YJXRGRGKDZWSJB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|